C12H14BrN3OS — CID 114903189
4-bromo-2-(5-oxo-1,4-diazepan-1-yl)benzenecarbothioamide (PubChem CID 114903189) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is 4-bromo-2-(5-oxo-1,4-diazepan-1-yl)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(5-oxo-1,4-diazepan-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114903189 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 4-bromo-2-(5-oxo-1,4-diazepan-1-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Br)cc1N1CCNC(=O)CC1 |
| InChI | InChI=1S/C12H14BrN3OS/c13-8-1-2-9(12(14)18)10(7-8)16-5-3-11(17)15-4-6-16/h1-2,7H,3-6H2,(H2,14,18)(H,15,17) |
| InChIKey | JRDICDDJYWVTMF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|