C13H13BrN2O2S — CID 107799160
4-bromo-2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide (PubChem CID 107799160) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 4-bromo-2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107799160 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 4-bromo-2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)benzenecarbothioamide |
| SMILES | CC1C(=O)N(c2cc(Br)ccc2C(N)=S)C(=O)C1C |
| InChI | InChI=1S/C13H13BrN2O2S/c1-6-7(2)13(18)16(12(6)17)10-5-8(14)3-4-9(10)11(15)19/h3-7H,1-2H3,(H2,15,19) |
| InChIKey | AXGYQRNNJAYKFU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|