C11H9BrN4O2S — CID 114903604
methyl 1-(5-bromo-2-carbamothioylphenyl)-1,2,4-triazole-3-carboxylate (PubChem CID 114903604) has the molecular formula C11H9BrN4O2S and a molecular weight of 341.19 g/mol. Its IUPAC name is methyl 1-(5-bromo-2-carbamothioylphenyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-(5-bromo-2-carbamothioylphenyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 114903604 |
| Molecular Formula | C11H9BrN4O2S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | methyl 1-(5-bromo-2-carbamothioylphenyl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(-c2cc(Br)ccc2C(N)=S)n1 |
| InChI | InChI=1S/C11H9BrN4O2S/c1-18-11(17)10-14-5-16(15-10)8-4-6(12)2-3-7(8)9(13)19/h2-5H,1H3,(H2,13,19) |
| InChIKey | KBMNICBJCXBLGO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|