C11H10BrN3O2 — CID 166607503
methyl 5-bromo-2-(3-methyl-1,2,4-triazol-1-yl)benzoate (PubChem CID 166607503) has the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. Its IUPAC name is methyl 5-bromo-2-(3-methyl-1,2,4-triazol-1-yl)benzoate.
| Compound Name | methyl 5-bromo-2-(3-methyl-1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 166607503 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | methyl 5-bromo-2-(3-methyl-1,2,4-triazol-1-yl)benzoate |
| SMILES | COC(=O)c1cc(Br)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C11H10BrN3O2/c1-7-13-6-15(14-7)10-4-3-8(12)5-9(10)11(16)17-2/h3-6H,1-2H3 |
| InChIKey | BBDUXYHSIWBRMF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |