C14H19BrN2O2 — CID 114904936
4-bromo-2-(2,6-dimethyloxan-4-yl)oxybenzenecarboximidamide (PubChem CID 114904936) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 4-bromo-2-(2,6-dimethyloxan-4-yl)oxybenzenecarboximidamide.
| Compound Name | 4-bromo-2-(2,6-dimethyloxan-4-yl)oxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114904936 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-bromo-2-(2,6-dimethyloxan-4-yl)oxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Br)cc1OC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-8-5-11(6-9(2)18-8)19-13-7-10(15)3-4-12(13)14(16)17/h3-4,7-9,11H,5-6H2,1-2H3,(H3,16,17) |
| InChIKey | ZIJGPHFNOCUNCZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|