C15H19BrN2OS — CID 114907910
3-amino-6-bromo-N-hexan-3-yl-1-benzothiophene-2-carboxamide (PubChem CID 114907910) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is 3-amino-6-bromo-N-hexan-3-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-hexan-3-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114907910 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-amino-6-bromo-N-hexan-3-yl-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(CC)NC(=O)c1sc2cc(Br)ccc2c1N |
| InChI | InChI=1S/C15H19BrN2OS/c1-3-5-10(4-2)18-15(19)14-13(17)11-7-6-9(16)8-12(11)20-14/h6-8,10H,3-5,17H2,1-2H3,(H,18,19) |
| InChIKey | DGOXXEBVNVYOCU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |