C9H7F3N4S — CID 114909096
2-methyl-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-1,2,4-triazole-3-thione (PubChem CID 114909096) has the molecular formula C9H7F3N4S and a molecular weight of 260.24 g/mol. Its IUPAC name is 2-methyl-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-methyl-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 114909096 |
| Molecular Formula | C9H7F3N4S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-methyl-5-[5-(trifluoromethyl)-2-pyridinyl]-1H-1,2,4-triazole-3-thione |
| SMILES | Cn1[nH]c(-c2ccc(C(F)(F)F)cn2)nc1=S |
| InChI | InChI=1S/C9H7F3N4S/c1-16-8(17)14-7(15-16)6-3-2-5(4-13-6)9(10,11)12/h2-4H,1H3,(H,14,15,17) |
| InChIKey | SNHLCVSXICOSLV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|