C30H44O18 — CID 11490942
[(2R,3R,4R,6S)-3-acetyloxy-2-[(2R,3R)-2,3-diacetyloxy-4-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]butyl]-6-methoxyoxan-4-yl] acetate (PubChem CID 11490942) has the molecular formula C30H44O18 and a molecular weight of 692.66 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-3-acetyloxy-2-[(2R,3R)-2,3-diacetyloxy-4-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]butyl]-6-methoxyoxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,6S)-3-acetyloxy-2-[(2R,3R)-2,3-diacetyloxy-4-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]butyl]-6-methoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 11490942 |
| Molecular Formula | C30H44O18 |
| Molecular Weight | 692.66 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | [(2R,3R,4R,6S)-3-acetyloxy-2-[(2R,3R)-2,3-diacetyloxy-4-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]butyl]-6-methoxyoxan-4-yl] acetate |
| SMILES | CO[C@@H]1C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C[C@@H](OC(C)=O)[C@@H](C[C@H]2O[C@H](OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C30H44O18/c1-13(31)40-20(10-22-26(43-16(4)34)24(42-15(3)33)12-25(38-8)47-22)21(41-14(2)32)11-23-27(44-17(5)35)28(45-18(6)36)29(46-19(7)37)30(39-9)48-23/h20-30H,10-12H2,1-9H3/t20-,21-,22-,23-,24-,25+,26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | VZDMXQAPGISVOC-OCUYOXLDSA-N |
| XLogP | 0.42 |
| TPSA | 221.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|