C11H11N5O3S — CID 114913311
4-[2-(thiatriazol-5-ylcarbamoylamino)ethyl]benzoic acid (PubChem CID 114913311) has the molecular formula C11H11N5O3S and a molecular weight of 293.31 g/mol. Its IUPAC name is 4-[2-(thiatriazol-5-ylcarbamoylamino)ethyl]benzoic acid.
| Compound Name | 4-[2-(thiatriazol-5-ylcarbamoylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 114913311 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-[2-(thiatriazol-5-ylcarbamoylamino)ethyl]benzoic acid |
| SMILES | O=C(NCCc1ccc(C(=O)O)cc1)Nc1nnns1 |
| InChI | InChI=1S/C11H11N5O3S/c17-9(18)8-3-1-7(2-4-8)5-6-12-10(19)13-11-14-15-16-20-11/h1-4H,5-6H2,(H,17,18)(H2,12,13,14,16,19) |
| InChIKey | JSPZRLNGMKSVRI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |