C12H13N5O3S — CID 114914231
4-nitro-3-(propylamino)-N-(thiadiazol-5-yl)benzamide (PubChem CID 114914231) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-nitro-3-(propylamino)-N-(thiadiazol-5-yl)benzamide.
| Compound Name | 4-nitro-3-(propylamino)-N-(thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 114914231 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-nitro-3-(propylamino)-N-(thiadiazol-5-yl)benzamide |
| SMILES | CCCNc1cc(C(=O)Nc2cnns2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O3S/c1-2-5-13-9-6-8(3-4-10(9)17(19)20)12(18)15-11-7-14-16-21-11/h3-4,6-7,13H,2,5H2,1H3,(H,15,18) |
| InChIKey | FMNWIODANDFEBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|