C11H12N6O3S — CID 114914364
4-nitro-3-(propylamino)-N-(thiatriazol-5-yl)benzamide (PubChem CID 114914364) has the molecular formula C11H12N6O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-nitro-3-(propylamino)-N-(thiatriazol-5-yl)benzamide.
| Compound Name | 4-nitro-3-(propylamino)-N-(thiatriazol-5-yl)benzamide |
|---|---|
| PubChem CID | 114914364 |
| Molecular Formula | C11H12N6O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-nitro-3-(propylamino)-N-(thiatriazol-5-yl)benzamide |
| SMILES | CCCNc1cc(C(=O)Nc2nnns2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N6O3S/c1-2-5-12-8-6-7(3-4-9(8)17(19)20)10(18)13-11-14-15-16-21-11/h3-4,6,12H,2,5H2,1H3,(H,13,14,16,18) |
| InChIKey | BHHUXMWYQOISLU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|