C12H16N2O3S2 — CID 114915571
methyl 4-methyl-3-(thiomorpholine-3-carbonylamino)thiophene-2-carboxylate (PubChem CID 114915571) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is methyl 4-methyl-3-(thiomorpholine-3-carbonylamino)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(thiomorpholine-3-carbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114915571 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 4-methyl-3-(thiomorpholine-3-carbonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NC(=O)C1CSCCN1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-7-5-19-10(12(16)17-2)9(7)14-11(15)8-6-18-4-3-13-8/h5,8,13H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | SLQUMMFBCLNLOC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |