C11H16N4OS — CID 82905664
N-(4,6-dimethylpyrimidin-2-yl)thiomorpholine-3-carboxamide (PubChem CID 82905664) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)thiomorpholine-3-carboxamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82905664 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)thiomorpholine-3-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)C2CSCCN2)n1 |
| InChI | InChI=1S/C11H16N4OS/c1-7-5-8(2)14-11(13-7)15-10(16)9-6-17-4-3-12-9/h5,9,12H,3-4,6H2,1-2H3,(H,13,14,15,16) |
| InChIKey | KXBKTFPNERARAL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |