C10H17N3O2S — CID 114932074
1-amino-N-(4,6-dimethyl-2-pyridinyl)propane-2-sulfonamide (PubChem CID 114932074) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-amino-N-(4,6-dimethyl-2-pyridinyl)propane-2-sulfonamide.
| Compound Name | 1-amino-N-(4,6-dimethyl-2-pyridinyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 114932074 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-amino-N-(4,6-dimethyl-2-pyridinyl)propane-2-sulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)C(C)CN)c1 |
| InChI | InChI=1S/C10H17N3O2S/c1-7-4-8(2)12-10(5-7)13-16(14,15)9(3)6-11/h4-5,9H,6,11H2,1-3H3,(H,12,13) |
| InChIKey | XXQAMFWSXWROJT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |