C17H18N2O2 — CID 114933739
3-(2,4-dimethoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyridine (PubChem CID 114933739) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyridine.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 114933739 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5,7-dimethylimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2cnc3cc(C)cc(C)n23)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-11-7-12(2)19-15(10-18-17(19)8-11)14-6-5-13(20-3)9-16(14)21-4/h5-10H,1-4H3 |
| InChIKey | ZCGCRPVTHIBCKY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |