C16H17N3O2 — CID 63617611
2-(2,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 63617611) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(2,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63617611 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1ccc(-c2nc3cc(C)ccn3c2N)c(OC)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-10-6-7-19-14(8-10)18-15(16(19)17)12-5-4-11(20-2)9-13(12)21-3/h4-9H,17H2,1-3H3 |
| InChIKey | FPCVBAKNYCYBSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |