C17H21ClN2O2 — CID 11493485
3-[(1,6-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1H-indole-2-carboxylic acid;hydrochloride (PubChem CID 11493485) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-[(1,6-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1H-indole-2-carboxylic acid;hydrochloride.
| Compound Name | 3-[(1,6-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1H-indole-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 11493485 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[(1,6-dimethyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1H-indole-2-carboxylic acid;hydrochloride |
| SMILES | CC1C(Cc2c(C(=O)O)[nH]c3ccccc23)=CCCN1C.Cl |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-11-12(6-5-9-19(11)2)10-14-13-7-3-4-8-15(13)18-16(14)17(20)21;/h3-4,6-8,11,18H,5,9-10H2,1-2H3,(H,20,21);1H |
| InChIKey | DMBITAUFWDEMGH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|