About 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene
2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene (PubChem CID 114934926) has the molecular formula C13H17BrF2
and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene |
| PubChem CID | 114934926 |
| Molecular Formula | C13H17BrF2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene |
| SMILES | CC(C)CC(CBr)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H17BrF2/c1-9(2)6-10(8-14)7-11-12(15)4-3-5-13(11)16/h3-5,9-10H,6-8H2,1-2H3 |
| InChIKey | XKZRCCCCBDCPPS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene?
The IUPAC name of 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene (CID 114934926) is 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene.
What is the SMILES notation for 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene?
The canonical SMILES for 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene is CC(C)CC(CBr)Cc1c(F)cccc1F.
What is the InChIKey of 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene?
The InChIKey is XKZRCCCCBDCPPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrF2/c1-9(2)6-10(8-14)7-11-12(15)4-3-5-13(11)16/h3-5,9-10H,6-8H2,1-2H3.
What are the key properties of 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene?
2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene has a molecular weight of 291.18 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(bromomethyl)-4-methylpentyl]-1,3-difluorobenzene is sourced from PubChem (CID 114934926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).