C17H27NO5 — CID 11493568
(3S,4S)-3,4-bis(methoxymethoxy)-1-(2-phenylmethoxyethyl)pyrrolidine (PubChem CID 11493568) has the molecular formula C17H27NO5 and a molecular weight of 325.40 g/mol. Its IUPAC name is (3S,4S)-3,4-bis(methoxymethoxy)-1-(2-phenylmethoxyethyl)pyrrolidine.
| Compound Name | (3S,4S)-3,4-bis(methoxymethoxy)-1-(2-phenylmethoxyethyl)pyrrolidine |
|---|---|
| PubChem CID | 11493568 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (3S,4S)-3,4-bis(methoxymethoxy)-1-(2-phenylmethoxyethyl)pyrrolidine |
| SMILES | COCO[C@H]1CN(CCOCc2ccccc2)C[C@@H]1OCOC |
| InChI | InChI=1S/C17H27NO5/c1-19-13-22-16-10-18(11-17(16)23-14-20-2)8-9-21-12-15-6-4-3-5-7-15/h3-7,16-17H,8-14H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | LJQSZNUGQMOHGX-IRXDYDNUSA-N |
| XLogP | 1.50 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|