C9H9N3O3 — CID 114939096
2-amino-5-(6-methoxy-3-pyridinyl)-1,3-oxazol-4-one (PubChem CID 114939096) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-amino-5-(6-methoxy-3-pyridinyl)-1,3-oxazol-4-one.
| Compound Name | 2-amino-5-(6-methoxy-3-pyridinyl)-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 114939096 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-amino-5-(6-methoxy-3-pyridinyl)-1,3-oxazol-4-one |
| SMILES | COc1ccc(C2OC(N)=NC2=O)cn1 |
| InChI | InChI=1S/C9H9N3O3/c1-14-6-3-2-5(4-11-6)7-8(13)12-9(10)15-7/h2-4,7H,1H3,(H2,10,12,13) |
| InChIKey | WICHSYOOEYMEAO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |