C16H17N5O2S — CID 11493918
2-[2-amino-4-(methylamino)quinazolin-7-yl]-N-methylbenzenesulfonamide (PubChem CID 11493918) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-[2-amino-4-(methylamino)quinazolin-7-yl]-N-methylbenzenesulfonamide.
| Compound Name | 2-[2-amino-4-(methylamino)quinazolin-7-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11493918 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[2-amino-4-(methylamino)quinazolin-7-yl]-N-methylbenzenesulfonamide |
| SMILES | CNc1nc(N)nc2cc(-c3ccccc3S(=O)(=O)NC)ccc12 |
| InChI | InChI=1S/C16H17N5O2S/c1-18-15-12-8-7-10(9-13(12)20-16(17)21-15)11-5-3-4-6-14(11)24(22,23)19-2/h3-9,19H,1-2H3,(H3,17,18,20,21) |
| InChIKey | PHYGRSSDPHUPNL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |