C18H38O4Si2 — CID 11494530
tert-butyl-[[(4R,5R)-2,2-dimethyl-5-(2-trimethylsilyloxyprop-2-enyl)-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 11494530) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is tert-butyl-[[(4R,5R)-2,2-dimethyl-5-(2-trimethylsilyloxyprop-2-enyl)-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R,5R)-2,2-dimethyl-5-(2-trimethylsilyloxyprop-2-enyl)-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11494530 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | tert-butyl-[[(4R,5R)-2,2-dimethyl-5-(2-trimethylsilyloxyprop-2-enyl)-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | C=C(C[C@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H38O4Si2/c1-14(22-23(7,8)9)12-15-16(21-18(5,6)20-15)13-19-24(10,11)17(2,3)4/h15-16H,1,12-13H2,2-11H3/t15-,16-/m1/s1 |
| InChIKey | VOHMCZYYFNZWND-HZPDHXFCSA-N |
| XLogP | 5.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|