C19H36O6Si — CID 11417867
ethyl 2-[(4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-ethoxy-5-methyl-1,3-dioxolan-2-yl]acetate (PubChem CID 11417867) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is ethyl 2-[(4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-ethoxy-5-methyl-1,3-dioxolan-2-yl]acetate.
| Compound Name | ethyl 2-[(4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-ethoxy-5-methyl-1,3-dioxolan-2-yl]acetate |
|---|---|
| PubChem CID | 11417867 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | ethyl 2-[(4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2-ethoxy-5-methyl-1,3-dioxolan-2-yl]acetate |
| SMILES | C=C(C[C@@H]1OC(CC(=O)OCC)(OCC)O[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O6Si/c1-10-21-17(20)13-19(22-11-2)23-15(4)16(24-19)12-14(3)25-26(8,9)18(5,6)7/h15-16H,3,10-13H2,1-2,4-9H3/t15-,16-,19?/m0/s1 |
| InChIKey | UXLZWSFXHPEGRH-NRAVZPKASA-N |
| XLogP | 4.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|