C23H44O5Si — CID 11453140
[(4R,5R)-2,2-dimethyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11453140) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is [(4R,5R)-2,2-dimethyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4R,5R)-2,2-dimethyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11453140 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | [(4R,5R)-2,2-dimethyl-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1OC(C)(C)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H44O5Si/c1-13-18(28-29(15(2)3,16(4)5)17(6)7)20-19(26-23(11,12)27-20)14-25-21(24)22(8,9)10/h13,15-20H,1,14H2,2-12H3/t18-,19+,20-/m0/s1 |
| InChIKey | ABIKVSVAUOMKJA-ZCNNSNEGSA-N |
| XLogP | 5.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|