C22H38O7 — CID 150249565
3-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,2-dimethylpropanoyloxy)but-3-enoxy]propyl 2,2-dimethylpropanoate (PubChem CID 150249565) has the molecular formula C22H38O7 and a molecular weight of 414.54 g/mol. Its IUPAC name is 3-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,2-dimethylpropanoyloxy)but-3-enoxy]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,2-dimethylpropanoyloxy)but-3-enoxy]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 150249565 |
| Molecular Formula | C22H38O7 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 3-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,2-dimethylpropanoyloxy)but-3-enoxy]propyl 2,2-dimethylpropanoate |
| SMILES | C=CC(OC(=O)C(C)(C)C)C(OCCCOC(=O)C(C)(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C22H38O7/c1-10-15(28-19(24)21(5,6)7)17(16-14-27-22(8,9)29-16)25-12-11-13-26-18(23)20(2,3)4/h10,15-17H,1,11-14H2,2-9H3 |
| InChIKey | FZGBQOYTCXSYFC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|