C24H32N2O2 — CID 11494652
[1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] (Z)-3-aminobut-2-enoate (PubChem CID 11494652) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] (Z)-3-aminobut-2-enoate.
| Compound Name | [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] (Z)-3-aminobut-2-enoate |
|---|---|
| PubChem CID | 11494652 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] (Z)-3-aminobut-2-enoate |
| SMILES | C/C(N)=C/C(=O)OC(C)(C)CN(C)CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-19(25)17-23(27)28-24(2,3)18-26(4)16-15-22(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,17,22H,15-16,18,25H2,1-4H3/b19-17- |
| InChIKey | QPEFCNZXMIYNLZ-ZPHPHTNESA-N |
| XLogP | 4.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|