C21H29NO3S — CID 16662826
[1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] methanesulfonate (PubChem CID 16662826) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] methanesulfonate.
| Compound Name | [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 16662826 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] methanesulfonate |
| SMILES | CN(CCC(c1ccccc1)c1ccccc1)CC(C)(C)OS(C)(=O)=O |
| InChI | InChI=1S/C21H29NO3S/c1-21(2,25-26(4,23)24)17-22(3)16-15-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20H,15-17H2,1-4H3 |
| InChIKey | OBUNKQZTVFGFPW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|