C23H33NO3S — CID 16662828
[1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] propane-1-sulfonate (PubChem CID 16662828) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] propane-1-sulfonate.
| Compound Name | [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] propane-1-sulfonate |
|---|---|
| PubChem CID | 16662828 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | [1-[3,3-diphenylpropyl(methyl)amino]-2-methylpropan-2-yl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OC(C)(C)CN(C)CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO3S/c1-5-18-28(25,26)27-23(2,3)19-24(4)17-16-22(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,22H,5,16-19H2,1-4H3 |
| InChIKey | ZXOGQZSRVMEVQJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|