C12H12F6O3S — CID 23206164
(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) propane-1-sulfonate (PubChem CID 23206164) has the molecular formula C12H12F6O3S and a molecular weight of 350.28 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) propane-1-sulfonate.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) propane-1-sulfonate |
|---|---|
| PubChem CID | 23206164 |
| Molecular Formula | C12H12F6O3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl) propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OC(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O3S/c1-2-8-22(19,20)21-10(11(13,14)15,12(16,17)18)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | QAOSKLDZKOEPFF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|