C19H25IO4S — CID 139721246
[[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenyl-λ3-iodanyl] propane-1-sulfonate (PubChem CID 139721246) has the molecular formula C19H25IO4S and a molecular weight of 476.38 g/mol. Its IUPAC name is [[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenyl-λ3-iodanyl] propane-1-sulfonate.
| Compound Name | [[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenyl-λ3-iodanyl] propane-1-sulfonate |
|---|---|
| PubChem CID | 139721246 |
| Molecular Formula | C19H25IO4S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | [[4-[(2-methylpropan-2-yl)oxy]phenyl]-phenyl-λ3-iodanyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OI(c1ccccc1)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H25IO4S/c1-5-15-25(21,22)24-20(16-9-7-6-8-10-16)17-11-13-18(14-12-17)23-19(2,3)4/h6-14H,5,15H2,1-4H3 |
| InChIKey | XXTMLYOLBAGJGC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|