C13H23F3N2O — CID 114947956
8,8-dimethyl-7-[(3,3,3-trifluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 114947956) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is 8,8-dimethyl-7-[(3,3,3-trifluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | 8,8-dimethyl-7-[(3,3,3-trifluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 114947956 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 8,8-dimethyl-7-[(3,3,3-trifluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)C2OCCCC2C1(N)CNCCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O/c1-11(2)10-9(4-3-7-19-10)12(11,17)8-18-6-5-13(14,15)16/h9-10,18H,3-8,17H2,1-2H3 |
| InChIKey | XIZMDHKJMARXIP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|