C15H25BrN2O2S — CID 114948344
4-[[[2-amino-1-(4-bromothiophen-2-yl)butyl]-methylamino]methyl]oxan-4-ol (PubChem CID 114948344) has the molecular formula C15H25BrN2O2S and a molecular weight of 377.35 g/mol. Its IUPAC name is 4-[[[2-amino-1-(4-bromothiophen-2-yl)butyl]-methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[[2-amino-1-(4-bromothiophen-2-yl)butyl]-methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 114948344 |
| Molecular Formula | C15H25BrN2O2S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 4-[[[2-amino-1-(4-bromothiophen-2-yl)butyl]-methylamino]methyl]oxan-4-ol |
| SMILES | CCC(N)C(c1cc(Br)cs1)N(C)CC1(O)CCOCC1 |
| InChI | InChI=1S/C15H25BrN2O2S/c1-3-12(17)14(13-8-11(16)9-21-13)18(2)10-15(19)4-6-20-7-5-15/h8-9,12,14,19H,3-7,10,17H2,1-2H3 |
| InChIKey | OOXFYCCBVSSTPB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |