C24H31N3O4 — CID 11495574
ethyl (2S)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]pentanoate (PubChem CID 11495574) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl (2S)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]pentanoate.
| Compound Name | ethyl (2S)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]pentanoate |
|---|---|
| PubChem CID | 11495574 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | ethyl (2S)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]pentanoate |
| SMILES | CCC[C@H](Oc1cccc2c(CCNC[C@H](O)c3cccnc3)c[nH]c12)C(=O)OCC |
| InChI | InChI=1S/C24H31N3O4/c1-3-7-22(24(29)30-4-2)31-21-10-5-9-19-17(15-27-23(19)21)11-13-26-16-20(28)18-8-6-12-25-14-18/h5-6,8-10,12,14-15,20,22,26-28H,3-4,7,11,13,16H2,1-2H3/t20-,22-/m0/s1 |
| InChIKey | IPPBGUHDXIEVBT-UNMCSNQZSA-N |
| XLogP | 3.54 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|