C29H38N4O4 — CID 69457845
(2S)-2-cyclohexyl-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylethanone (PubChem CID 69457845) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylethanone.
| Compound Name | (2S)-2-cyclohexyl-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 69457845 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylethanone |
| SMILES | O=C([C@@H](Oc1cccc2c(CCNC[C@H](O)c3cccnc3)c[nH]c12)C1CCCCC1)N1CCOCC1 |
| InChI | InChI=1S/C29H38N4O4/c34-25(23-8-5-12-30-18-23)20-31-13-11-22-19-32-27-24(22)9-4-10-26(27)37-28(21-6-2-1-3-7-21)29(35)33-14-16-36-17-15-33/h4-5,8-10,12,18-19,21,25,28,31-32,34H,1-3,6-7,11,13-17,20H2/t25-,28-/m0/s1 |
| InChIKey | LFORNGPAQISBCB-LSYYVWMOSA-N |
| XLogP | 3.62 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|