C24H30N4O4 — CID 69459962
(2R)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylpropan-1-one (PubChem CID 69459962) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (2R)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2R)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 69459962 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2R)-2-[[3-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]-1H-indol-7-yl]oxy]-1-morpholin-4-ylpropan-1-one |
| SMILES | C[C@@H](Oc1cccc2c(CCNC[C@H](O)c3cccnc3)c[nH]c12)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H30N4O4/c1-17(24(30)28-10-12-31-13-11-28)32-22-6-2-5-20-18(15-27-23(20)22)7-9-26-16-21(29)19-4-3-8-25-14-19/h2-6,8,14-15,17,21,26-27,29H,7,9-13,16H2,1H3/t17-,21+/m1/s1 |
| InChIKey | FWFJQBDYXNDPHP-UTKZUKDTSA-N |
| XLogP | 2.05 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|