C11H16FN3O4S2 — CID 114958433
4-[(4-methylpiperazin-1-yl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114958433) has the molecular formula C11H16FN3O4S2 and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[(4-methylpiperazin-1-yl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114958433 |
| Molecular Formula | C11H16FN3O4S2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CN1CCN(NS(=O)(=O)c2ccc(S(=O)(=O)F)cc2)CC1 |
| InChI | InChI=1S/C11H16FN3O4S2/c1-14-6-8-15(9-7-14)13-21(18,19)11-4-2-10(3-5-11)20(12,16)17/h2-5,13H,6-9H2,1H3 |
| InChIKey | QVSKKANIZYVNGY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |