C10H17N3O2S — CID 114958655
1-amino-4-[[propyl(sulfamoyl)amino]methyl]benzene (PubChem CID 114958655) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-amino-4-[[propyl(sulfamoyl)amino]methyl]benzene.
| Compound Name | 1-amino-4-[[propyl(sulfamoyl)amino]methyl]benzene |
|---|---|
| PubChem CID | 114958655 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-amino-4-[[propyl(sulfamoyl)amino]methyl]benzene |
| SMILES | CCCN(Cc1ccc(N)cc1)S(N)(=O)=O |
| InChI | InChI=1S/C10H17N3O2S/c1-2-7-13(16(12,14)15)8-9-3-5-10(11)6-4-9/h3-6H,2,7-8,11H2,1H3,(H2,12,14,15) |
| InChIKey | NRSHOUFLDKJGBS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|