C12H20N2O4S2 — CID 63245077
N-[(4-aminophenyl)methyl]-N-ethyl-2-methylsulfonylethanesulfonamide (PubChem CID 63245077) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-ethyl-2-methylsulfonylethanesulfonamide.
| Compound Name | N-[(4-aminophenyl)methyl]-N-ethyl-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 63245077 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-ethyl-2-methylsulfonylethanesulfonamide |
| SMILES | CCN(Cc1ccc(N)cc1)S(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O4S2/c1-3-14(10-11-4-6-12(13)7-5-11)20(17,18)9-8-19(2,15)16/h4-7H,3,8-10,13H2,1-2H3 |
| InChIKey | NJNMQZYTSPETEQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|