C10H14F2N2O2S — CID 43458785
N-[(4-aminophenyl)methyl]-N-ethyl-1,1-difluoromethanesulfonamide (PubChem CID 43458785) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-ethyl-1,1-difluoromethanesulfonamide.
| Compound Name | N-[(4-aminophenyl)methyl]-N-ethyl-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 43458785 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-ethyl-1,1-difluoromethanesulfonamide |
| SMILES | CCN(Cc1ccc(N)cc1)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H14F2N2O2S/c1-2-14(17(15,16)10(11)12)7-8-3-5-9(13)6-4-8/h3-6,10H,2,7,13H2,1H3 |
| InChIKey | UVPMMMJRPDQFFM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|