C22H24BrFN2O2 — CID 11496047
tert-butyl (1R,4S)-2-[6-bromo-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 11496047) has the molecular formula C22H24BrFN2O2 and a molecular weight of 447.35 g/mol. Its IUPAC name is tert-butyl (1R,4S)-2-[6-bromo-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl (1R,4S)-2-[6-bromo-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 11496047 |
| Molecular Formula | C22H24BrFN2O2 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | tert-butyl (1R,4S)-2-[6-bromo-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1C(c1cnc(Br)c(-c3ccc(F)cc3)c1)C2 |
| InChI | InChI=1S/C22H24BrFN2O2/c1-22(2,3)28-21(27)26-16-8-9-19(26)17(11-16)14-10-18(20(23)25-12-14)13-4-6-15(24)7-5-13/h4-7,10,12,16-17,19H,8-9,11H2,1-3H3/t16-,17?,19+/m0/s1 |
| InChIKey | KFHOBXDJVIJMMN-LVLJQFTKSA-N |
| XLogP | 5.91 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|