C12H22O2 — CID 114962373
3-methyl-1-(2,4,5-trimethyloxolan-3-yl)butan-1-one (PubChem CID 114962373) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-methyl-1-(2,4,5-trimethyloxolan-3-yl)butan-1-one.
| Compound Name | 3-methyl-1-(2,4,5-trimethyloxolan-3-yl)butan-1-one |
|---|---|
| PubChem CID | 114962373 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3-methyl-1-(2,4,5-trimethyloxolan-3-yl)butan-1-one |
| SMILES | CC(C)CC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C12H22O2/c1-7(2)6-11(13)12-8(3)9(4)14-10(12)5/h7-10,12H,6H2,1-5H3 |
| InChIKey | LBPAUFIFKZXQQM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |