C14H19ClO2 — CID 114968584
1-(5-chloro-2-methoxyphenyl)-3,4-dimethylpentan-2-one (PubChem CID 114968584) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3,4-dimethylpentan-2-one.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 114968584 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3,4-dimethylpentan-2-one |
| SMILES | COc1ccc(Cl)cc1CC(=O)C(C)C(C)C |
| InChI | InChI=1S/C14H19ClO2/c1-9(2)10(3)13(16)8-11-7-12(15)5-6-14(11)17-4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | IITWIZWFGYOXHX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |