C24H38O5S2Si — CID 11496980
methyl 3-oxo-4-[2-[(2R)-3-phenylmethoxy-2-triethylsilyloxypropyl]-1,3-dithiolan-2-yl]butanoate (PubChem CID 11496980) has the molecular formula C24H38O5S2Si and a molecular weight of 498.78 g/mol. Its IUPAC name is methyl 3-oxo-4-[2-[(2R)-3-phenylmethoxy-2-triethylsilyloxypropyl]-1,3-dithiolan-2-yl]butanoate.
| Compound Name | methyl 3-oxo-4-[2-[(2R)-3-phenylmethoxy-2-triethylsilyloxypropyl]-1,3-dithiolan-2-yl]butanoate |
|---|---|
| PubChem CID | 11496980 |
| Molecular Formula | C24H38O5S2Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | methyl 3-oxo-4-[2-[(2R)-3-phenylmethoxy-2-triethylsilyloxypropyl]-1,3-dithiolan-2-yl]butanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](COCc1ccccc1)CC1(CC(=O)CC(=O)OC)SCCS1 |
| InChI | InChI=1S/C24H38O5S2Si/c1-5-32(6-2,7-3)29-22(19-28-18-20-11-9-8-10-12-20)17-24(30-13-14-31-24)16-21(25)15-23(26)27-4/h8-12,22H,5-7,13-19H2,1-4H3/t22-/m1/s1 |
| InChIKey | IWHJPSGVOZQNKV-JOCHJYFZSA-N |
| XLogP | 5.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|