C15H12O3S2 — CID 114971200
(2,4-dimethoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 114971200) has the molecular formula C15H12O3S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | (2,4-dimethoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 114971200 |
| Molecular Formula | C15H12O3S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (2,4-dimethoxyphenyl)-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | COc1ccc(C(=O)c2cc3sccc3s2)c(OC)c1 |
| InChI | InChI=1S/C15H12O3S2/c1-17-9-3-4-10(11(7-9)18-2)15(16)14-8-13-12(20-14)5-6-19-13/h3-8H,1-2H3 |
| InChIKey | PCEIOFRJYFVCTG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |