C12H12O3 — CID 114971760
furan-3-yl-(2,4,5-trimethylfuran-3-yl)methanone (PubChem CID 114971760) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is furan-3-yl-(2,4,5-trimethylfuran-3-yl)methanone.
| Compound Name | furan-3-yl-(2,4,5-trimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 114971760 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | furan-3-yl-(2,4,5-trimethylfuran-3-yl)methanone |
| SMILES | Cc1oc(C)c(C(=O)c2ccoc2)c1C |
| InChI | InChI=1S/C12H12O3/c1-7-8(2)15-9(3)11(7)12(13)10-4-5-14-6-10/h4-6H,1-3H3 |
| InChIKey | CEYVNBOKJLCMHS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |