C12H16N2O — CID 114973069
pyrazin-2-yl-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 114973069) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is pyrazin-2-yl-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | pyrazin-2-yl-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 114973069 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | pyrazin-2-yl-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1(C)C(C(=O)c2cnccn2)C1(C)C |
| InChI | InChI=1S/C12H16N2O/c1-11(2)10(12(11,3)4)9(15)8-7-13-5-6-14-8/h5-7,10H,1-4H3 |
| InChIKey | MTOSZAHMGPTHCZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |