C15H21BrN2 — CID 114985358
N-[(1R)-1-(4-bromophenyl)ethyl]-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 114985358) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-1-azabicyclo[3.2.1]octan-4-amine.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-1-azabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 114985358 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | C[C@@H](NC1CCN2CCC1C2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2/c1-11(12-2-4-14(16)5-3-12)17-15-7-9-18-8-6-13(15)10-18/h2-5,11,13,15,17H,6-10H2,1H3/t11-,13?,15?/m1/s1 |
| InChIKey | TVTWNEFNHAMMPB-NUYPLMSZSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |