C15H20BrClN2 — CID 82774176
N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 82774176) has the molecular formula C15H20BrClN2 and a molecular weight of 343.70 g/mol. Its IUPAC name is N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 82774176 |
| Molecular Formula | C15H20BrClN2 |
| Molecular Weight | 343.70 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CC(NC1CN2CCC1CC2)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H20BrClN2/c1-10(13-3-2-12(16)8-14(13)17)18-15-9-19-6-4-11(15)5-7-19/h2-3,8,10-11,15,18H,4-7,9H2,1H3 |
| InChIKey | IQZCOMXSMOWPCR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |