C9H18N4O — CID 114986524
(2S)-3-methyl-2-[(3-methyltriazol-4-yl)methylamino]butan-1-ol (PubChem CID 114986524) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(3-methyltriazol-4-yl)methylamino]butan-1-ol.
| Compound Name | (2S)-3-methyl-2-[(3-methyltriazol-4-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 114986524 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (2S)-3-methyl-2-[(3-methyltriazol-4-yl)methylamino]butan-1-ol |
| SMILES | CC(C)[C@@H](CO)NCc1cnnn1C |
| InChI | InChI=1S/C9H18N4O/c1-7(2)9(6-14)10-4-8-5-11-12-13(8)3/h5,7,9-10,14H,4,6H2,1-3H3/t9-/m1/s1 |
| InChIKey | MNXIGWUBUUSYRL-SECBINFHSA-N |
| XLogP | -0.08 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |