C9H18N4S — CID 115682796
1-ethylsulfanyl-N-[(3-methyltriazol-4-yl)methyl]propan-2-amine (PubChem CID 115682796) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is 1-ethylsulfanyl-N-[(3-methyltriazol-4-yl)methyl]propan-2-amine.
| Compound Name | 1-ethylsulfanyl-N-[(3-methyltriazol-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 115682796 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-ethylsulfanyl-N-[(3-methyltriazol-4-yl)methyl]propan-2-amine |
| SMILES | CCSCC(C)NCc1cnnn1C |
| InChI | InChI=1S/C9H18N4S/c1-4-14-7-8(2)10-5-9-6-11-12-13(9)3/h6,8,10H,4-5,7H2,1-3H3 |
| InChIKey | OHXNMLQRSHOYAV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |